C21H20ClNO3S — CID 22554411
N-[2-(4-chlorophenyl)ethyl]-5-[(3-methylphenyl)sulfinylmethyl]furan-2-carboxamide (PubChem CID 22554411) has the molecular formula C21H20ClNO3S and a molecular weight of 401.92 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)ethyl]-5-[(3-methylphenyl)sulfinylmethyl]furan-2-carboxamide.
| Compound Name | N-[2-(4-chlorophenyl)ethyl]-5-[(3-methylphenyl)sulfinylmethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 22554411 |
| Molecular Formula | C21H20ClNO3S |
| Molecular Weight | 401.92 g/mol |
| Exact Mass | 401.09 |
| IUPAC Name | N-[2-(4-chlorophenyl)ethyl]-5-[(3-methylphenyl)sulfinylmethyl]furan-2-carboxamide |
| SMILES | Cc1cccc(S(=O)Cc2ccc(C(=O)NCCc3ccc(Cl)cc3)o2)c1 |
| InChI | InChI=1S/C21H20ClNO3S/c1-15-3-2-4-19(13-15)27(25)14-18-9-10-20(26-18)21(24)23-12-11-16-5-7-17(22)8-6-16/h2-10,13H,11-12,14H2,1H3,(H,23,24) |
| InChIKey | JUCIAYQJBUCLOB-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.92 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |