C19H15BrFNO3S — CID 92687530
N-[(2-bromophenyl)methyl]-5-[[(R)-(4-fluorophenyl)sulfinyl]methyl]furan-2-carboxamide (PubChem CID 92687530) has the molecular formula C19H15BrFNO3S and a molecular weight of 436.30 g/mol. Its IUPAC name is N-[(2-bromophenyl)methyl]-5-[[(R)-(4-fluorophenyl)sulfinyl]methyl]furan-2-carboxamide.
| Compound Name | N-[(2-bromophenyl)methyl]-5-[[(R)-(4-fluorophenyl)sulfinyl]methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 92687530 |
| Molecular Formula | C19H15BrFNO3S |
| Molecular Weight | 436.30 g/mol |
| Exact Mass | 434.99 |
| IUPAC Name | N-[(2-bromophenyl)methyl]-5-[[(R)-(4-fluorophenyl)sulfinyl]methyl]furan-2-carboxamide |
| SMILES | O=C(NCc1ccccc1Br)c1ccc(C[S@@](=O)c2ccc(F)cc2)o1 |
| InChI | InChI=1S/C19H15BrFNO3S/c20-17-4-2-1-3-13(17)11-22-19(23)18-10-7-15(25-18)12-26(24)16-8-5-14(21)6-9-16/h1-10H,11-12H2,(H,22,23)/t26-/m1/s1 |
| InChIKey | HCAZEBXHVSMXET-AREMUKBSSA-N |
| XLogP | 4.42 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.30 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |