C23H25BrN2O3S — CID 22554639
N-[3-[benzyl(methyl)amino]propyl]-5-[(4-bromophenyl)sulfinylmethyl]furan-2-carboxamide (PubChem CID 22554639) has the molecular formula C23H25BrN2O3S and a molecular weight of 489.44 g/mol. Its IUPAC name is N-[3-[benzyl(methyl)amino]propyl]-5-[(4-bromophenyl)sulfinylmethyl]furan-2-carboxamide.
| Compound Name | N-[3-[benzyl(methyl)amino]propyl]-5-[(4-bromophenyl)sulfinylmethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 22554639 |
| Molecular Formula | C23H25BrN2O3S |
| Molecular Weight | 489.44 g/mol |
| Exact Mass | 488.08 |
| IUPAC Name | N-[3-[benzyl(methyl)amino]propyl]-5-[(4-bromophenyl)sulfinylmethyl]furan-2-carboxamide |
| SMILES | CN(CCCNC(=O)c1ccc(CS(=O)c2ccc(Br)cc2)o1)Cc1ccccc1 |
| InChI | InChI=1S/C23H25BrN2O3S/c1-26(16-18-6-3-2-4-7-18)15-5-14-25-23(27)22-13-10-20(29-22)17-30(28)21-11-8-19(24)9-12-21/h2-4,6-13H,5,14-17H2,1H3,(H,25,27) |
| InChIKey | QLFGIQFTGITXLP-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.44 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|