C19H19NO4S2 — CID 22554763
5-[(4-methoxyphenyl)sulfinylmethyl]-N-(2-thiophen-2-ylethyl)furan-2-carboxamide (PubChem CID 22554763) has the molecular formula C19H19NO4S2 and a molecular weight of 389.50 g/mol. Its IUPAC name is 5-[(4-methoxyphenyl)sulfinylmethyl]-N-(2-thiophen-2-ylethyl)furan-2-carboxamide.
| Compound Name | 5-[(4-methoxyphenyl)sulfinylmethyl]-N-(2-thiophen-2-ylethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 22554763 |
| Molecular Formula | C19H19NO4S2 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.08 |
| IUPAC Name | 5-[(4-methoxyphenyl)sulfinylmethyl]-N-(2-thiophen-2-ylethyl)furan-2-carboxamide |
| SMILES | COc1ccc(S(=O)Cc2ccc(C(=O)NCCc3cccs3)o2)cc1 |
| InChI | InChI=1S/C19H19NO4S2/c1-23-14-4-7-17(8-5-14)26(22)13-15-6-9-18(24-15)19(21)20-11-10-16-3-2-12-25-16/h2-9,12H,10-11,13H2,1H3,(H,20,21) |
| InChIKey | OWUGITVAFBFJAB-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |