C18H21BrN2O4S — CID 45106543
5-[(4-bromophenyl)sulfinylmethyl]-N-(2-morpholin-4-ylethyl)furan-2-carboxamide (PubChem CID 45106543) has the molecular formula C18H21BrN2O4S and a molecular weight of 441.35 g/mol. Its IUPAC name is 5-[(4-bromophenyl)sulfinylmethyl]-N-(2-morpholin-4-ylethyl)furan-2-carboxamide.
| Compound Name | 5-[(4-bromophenyl)sulfinylmethyl]-N-(2-morpholin-4-ylethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 45106543 |
| Molecular Formula | C18H21BrN2O4S |
| Molecular Weight | 441.35 g/mol |
| Exact Mass | 440.04 |
| IUPAC Name | 5-[(4-bromophenyl)sulfinylmethyl]-N-(2-morpholin-4-ylethyl)furan-2-carboxamide |
| SMILES | O=C(NCCN1CCOCC1)c1ccc(CS(=O)c2ccc(Br)cc2)o1 |
| InChI | InChI=1S/C18H21BrN2O4S/c19-14-1-4-16(5-2-14)26(23)13-15-3-6-17(25-15)18(22)20-7-8-21-9-11-24-12-10-21/h1-6H,7-13H2,(H,20,22) |
| InChIKey | XXSQHDABBQWGKU-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.35 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |