C18H17F5N2O4 — CID 19461514
N-(2-morpholin-4-ylethyl)-5-[(2,3,4,5,6-pentafluorophenoxy)methyl]furan-2-carboxamide (PubChem CID 19461514) has the molecular formula C18H17F5N2O4 and a molecular weight of 420.33 g/mol. Its IUPAC name is N-(2-morpholin-4-ylethyl)-5-[(2,3,4,5,6-pentafluorophenoxy)methyl]furan-2-carboxamide.
| Compound Name | N-(2-morpholin-4-ylethyl)-5-[(2,3,4,5,6-pentafluorophenoxy)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19461514 |
| Molecular Formula | C18H17F5N2O4 |
| Molecular Weight | 420.33 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | N-(2-morpholin-4-ylethyl)-5-[(2,3,4,5,6-pentafluorophenoxy)methyl]furan-2-carboxamide |
| SMILES | O=C(NCCN1CCOCC1)c1ccc(COc2c(F)c(F)c(F)c(F)c2F)o1 |
| InChI | InChI=1S/C18H17F5N2O4/c19-12-13(20)15(22)17(16(23)14(12)21)28-9-10-1-2-11(29-10)18(26)24-3-4-25-5-7-27-8-6-25/h1-2H,3-9H2,(H,24,26) |
| InChIKey | NDMIZDZUIUNGDN-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 63.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.33 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|