C17H11F5N4O5 — CID 19281788
N-[2-(4-nitropyrazol-1-yl)ethyl]-5-[(2,3,4,5,6-pentafluorophenoxy)methyl]furan-2-carboxamide (PubChem CID 19281788) has the molecular formula C17H11F5N4O5 and a molecular weight of 446.29 g/mol. Its IUPAC name is N-[2-(4-nitropyrazol-1-yl)ethyl]-5-[(2,3,4,5,6-pentafluorophenoxy)methyl]furan-2-carboxamide.
| Compound Name | N-[2-(4-nitropyrazol-1-yl)ethyl]-5-[(2,3,4,5,6-pentafluorophenoxy)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 19281788 |
| Molecular Formula | C17H11F5N4O5 |
| Molecular Weight | 446.29 g/mol |
| Exact Mass | 446.06 |
| IUPAC Name | N-[2-(4-nitropyrazol-1-yl)ethyl]-5-[(2,3,4,5,6-pentafluorophenoxy)methyl]furan-2-carboxamide |
| SMILES | O=C(NCCn1cc([N+](=O)[O-])cn1)c1ccc(COc2c(F)c(F)c(F)c(F)c2F)o1 |
| InChI | InChI=1S/C17H11F5N4O5/c18-11-12(19)14(21)16(15(22)13(11)20)30-7-9-1-2-10(31-9)17(27)23-3-4-25-6-8(5-24-25)26(28)29/h1-2,5-6H,3-4,7H2,(H,23,27) |
| InChIKey | GHXXLNQZUSVRNN-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 112.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.29 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|