C14H10Cl2O5 — CID 82140494
5-[2-carboxy-2-(2,6-dichlorophenyl)ethyl]furan-2-carboxylic acid (PubChem CID 82140494) has the molecular formula C14H10Cl2O5 and a molecular weight of 329.14 g/mol. Its IUPAC name is 5-[2-carboxy-2-(2,6-dichlorophenyl)ethyl]furan-2-carboxylic acid.
| Compound Name | 5-[2-carboxy-2-(2,6-dichlorophenyl)ethyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 82140494 |
| Molecular Formula | C14H10Cl2O5 |
| Molecular Weight | 329.14 g/mol |
| Exact Mass | 327.99 |
| IUPAC Name | 5-[2-carboxy-2-(2,6-dichlorophenyl)ethyl]furan-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(CC(C(=O)O)c2c(Cl)cccc2Cl)o1 |
| InChI | InChI=1S/C14H10Cl2O5/c15-9-2-1-3-10(16)12(9)8(13(17)18)6-7-4-5-11(21-7)14(19)20/h1-5,8H,6H2,(H,17,18)(H,19,20) |
| InChIKey | LLAMQHSWWYAVPY-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.14 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |