5-[(3,5-dimethylphenyl)sulfinylmethyl]furan-2-carboxylic acid

C14H14O4S — CID 53212367

IUPAC5-[(3,5-dimethylphenyl)sulfinylmethyl]furan-2-carboxylic acid
SMILESCc1cc(C)cc(S(=O)Cc2ccc(C(=O)O)o2)c1
InChIInChI=1S/C14H14O4S/c1-9-5-10(2)7-12(6-9)19(17)8-11-3-4-13(18-11)14(15)16/h3-7H,8H2,1-2H3,(H,15,16)
InChIKeySOFKOEIZQSCOGS-UHFFFAOYSA-N
MW278.33 g/mol
LogP2.90
Rot. Bonds4

About 5-[(3,5-dimethylphenyl)sulfinylmethyl]furan-2-carboxylic acid

5-[(3,5-dimethylphenyl)sulfinylmethyl]furan-2-carboxylic acid (PubChem CID 53212367) has the molecular formula C14H14O4S and a molecular weight of 278.33 g/mol. Its IUPAC name is 5-[(3,5-dimethylphenyl)sulfinylmethyl]furan-2-carboxylic acid.

Molecular Properties

Compound Name5-[(3,5-dimethylphenyl)sulfinylmethyl]furan-2-carboxylic acid
PubChem CID53212367
Molecular FormulaC14H14O4S
Molecular Weight278.33 g/mol
Exact Mass278.06
IUPAC Name5-[(3,5-dimethylphenyl)sulfinylmethyl]furan-2-carboxylic acid
SMILESCc1cc(C)cc(S(=O)Cc2ccc(C(=O)O)o2)c1
InChIInChI=1S/C14H14O4S/c1-9-5-10(2)7-12(6-9)19(17)8-11-3-4-13(18-11)14(15)16/h3-7H,8H2,1-2H3,(H,15,16)
InChIKeySOFKOEIZQSCOGS-UHFFFAOYSA-N
XLogP2.90
TPSA67.51 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500278.33
LogP ≤ 52.90
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 5-[(3,5-dimethylphenyl)sulfinylmethyl]furan-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-[(3,5-dimethylphenyl)sulfinylmethyl]furan-2-carboxylic acid?
The IUPAC name of 5-[(3,5-dimethylphenyl)sulfinylmethyl]furan-2-carboxylic acid (CID 53212367) is 5-[(3,5-dimethylphenyl)sulfinylmethyl]furan-2-carboxylic acid.
What is the SMILES notation for 5-[(3,5-dimethylphenyl)sulfinylmethyl]furan-2-carboxylic acid?
The canonical SMILES for 5-[(3,5-dimethylphenyl)sulfinylmethyl]furan-2-carboxylic acid is Cc1cc(C)cc(S(=O)Cc2ccc(C(=O)O)o2)c1.
What is the InChIKey of 5-[(3,5-dimethylphenyl)sulfinylmethyl]furan-2-carboxylic acid?
The InChIKey is SOFKOEIZQSCOGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14O4S/c1-9-5-10(2)7-12(6-9)19(17)8-11-3-4-13(18-11)14(15)16/h3-7H,8H2,1-2H3,(H,15,16).
What are the key properties of 5-[(3,5-dimethylphenyl)sulfinylmethyl]furan-2-carboxylic acid?
5-[(3,5-dimethylphenyl)sulfinylmethyl]furan-2-carboxylic acid has a molecular weight of 278.33 g/mol, XLogP of 2.90, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(3,5-dimethylphenyl)sulfinylmethyl]furan-2-carboxylic acid is sourced from PubChem (CID 53212367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).