C17H20O5S — CID 123122722
5-[4-(3-methylphenoxy)butylsulfinylmethyl]furan-2-carboxylic acid (PubChem CID 123122722) has the molecular formula C17H20O5S and a molecular weight of 336.41 g/mol. Its IUPAC name is 5-[4-(3-methylphenoxy)butylsulfinylmethyl]furan-2-carboxylic acid.
| Compound Name | 5-[4-(3-methylphenoxy)butylsulfinylmethyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 123122722 |
| Molecular Formula | C17H20O5S |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | 5-[4-(3-methylphenoxy)butylsulfinylmethyl]furan-2-carboxylic acid |
| SMILES | Cc1cccc(OCCCCS(=O)Cc2ccc(C(=O)O)o2)c1 |
| InChI | InChI=1S/C17H20O5S/c1-13-5-4-6-14(11-13)21-9-2-3-10-23(20)12-15-7-8-16(22-15)17(18)19/h4-8,11H,2-3,9-10,12H2,1H3,(H,18,19) |
| InChIKey | ZDOJYJIMKKNUJJ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|