C14H14O4S — CID 63941993
5-[2-(3-methylphenoxy)ethylsulfanyl]furan-2-carboxylic acid (PubChem CID 63941993) has the molecular formula C14H14O4S and a molecular weight of 278.33 g/mol. Its IUPAC name is 5-[2-(3-methylphenoxy)ethylsulfanyl]furan-2-carboxylic acid.
| Compound Name | 5-[2-(3-methylphenoxy)ethylsulfanyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 63941993 |
| Molecular Formula | C14H14O4S |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | 5-[2-(3-methylphenoxy)ethylsulfanyl]furan-2-carboxylic acid |
| SMILES | Cc1cccc(OCCSc2ccc(C(=O)O)o2)c1 |
| InChI | InChI=1S/C14H14O4S/c1-10-3-2-4-11(9-10)17-7-8-19-13-6-5-12(18-13)14(15)16/h2-6,9H,7-8H2,1H3,(H,15,16) |
| InChIKey | NMPUTJLWURFIDL-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|