About 5-[(2,4-dimethylphenyl)sulfinylmethyl]furan-2-carboxylic acid
5-[(2,4-dimethylphenyl)sulfinylmethyl]furan-2-carboxylic acid (PubChem CID 61304332) has the molecular formula C14H14O4S
and a molecular weight of 278.33 g/mol. Its IUPAC name is 5-[(2,4-dimethylphenyl)sulfinylmethyl]furan-2-carboxylic acid.
Analyze 5-[(2,4-dimethylphenyl)sulfinylmethyl]furan-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2,4-dimethylphenyl)sulfinylmethyl]furan-2-carboxylic acid?
The IUPAC name of 5-[(2,4-dimethylphenyl)sulfinylmethyl]furan-2-carboxylic acid (CID 61304332) is 5-[(2,4-dimethylphenyl)sulfinylmethyl]furan-2-carboxylic acid.
What is the SMILES notation for 5-[(2,4-dimethylphenyl)sulfinylmethyl]furan-2-carboxylic acid?
The canonical SMILES for 5-[(2,4-dimethylphenyl)sulfinylmethyl]furan-2-carboxylic acid is Cc1ccc(S(=O)Cc2ccc(C(=O)O)o2)c(C)c1.
What is the InChIKey of 5-[(2,4-dimethylphenyl)sulfinylmethyl]furan-2-carboxylic acid?
The InChIKey is JLERVBZXBNHOET-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14O4S/c1-9-3-6-13(10(2)7-9)19(17)8-11-4-5-12(18-11)14(15)16/h3-7H,8H2,1-2H3,(H,15,16).
What are the key properties of 5-[(2,4-dimethylphenyl)sulfinylmethyl]furan-2-carboxylic acid?
5-[(2,4-dimethylphenyl)sulfinylmethyl]furan-2-carboxylic acid has a molecular weight of 278.33 g/mol, XLogP of 2.90, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2,4-dimethylphenyl)sulfinylmethyl]furan-2-carboxylic acid is sourced from PubChem (CID 61304332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).