C18H22ClN2O5S+ — CID 4104659
5-[(4-chlorophenyl)sulfonylmethyl]-N-(2-morpholin-4-ium-4-ylethyl)furan-2-carboxamide (PubChem CID 4104659) has the molecular formula C18H22ClN2O5S+ and a molecular weight of 413.90 g/mol. Its IUPAC name is 5-[(4-chlorophenyl)sulfonylmethyl]-N-(2-morpholin-4-ium-4-ylethyl)furan-2-carboxamide.
| Compound Name | 5-[(4-chlorophenyl)sulfonylmethyl]-N-(2-morpholin-4-ium-4-ylethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 4104659 |
| Molecular Formula | C18H22ClN2O5S+ |
| Molecular Weight | 413.90 g/mol |
| Exact Mass | 413.09 |
| IUPAC Name | 5-[(4-chlorophenyl)sulfonylmethyl]-N-(2-morpholin-4-ium-4-ylethyl)furan-2-carboxamide |
| SMILES | O=C(NCC[NH+]1CCOCC1)c1ccc(CS(=O)(=O)c2ccc(Cl)cc2)o1 |
| InChI | InChI=1S/C18H21ClN2O5S/c19-14-1-4-16(5-2-14)27(23,24)13-15-3-6-17(26-15)18(22)20-7-8-21-9-11-25-12-10-21/h1-6H,7-13H2,(H,20,22)/p+1 |
| InChIKey | PYVWZSRAFBXIOQ-UHFFFAOYSA-O |
| XLogP | 0.55 |
| TPSA | 90.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.90 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |