C24H26BrN2O4S+ — CID 3312100
5-[(4-bromophenyl)sulfonylmethyl]-N-[3-(1,2,3,4-tetrahydroisoquinolin-2-ium-2-yl)propyl]furan-2-carboxamide (PubChem CID 3312100) has the molecular formula C24H26BrN2O4S+ and a molecular weight of 518.45 g/mol. Its IUPAC name is 5-[(4-bromophenyl)sulfonylmethyl]-N-[3-(1,2,3,4-tetrahydroisoquinolin-2-ium-2-yl)propyl]furan-2-carboxamide.
| Compound Name | 5-[(4-bromophenyl)sulfonylmethyl]-N-[3-(1,2,3,4-tetrahydroisoquinolin-2-ium-2-yl)propyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 3312100 |
| Molecular Formula | C24H26BrN2O4S+ |
| Molecular Weight | 518.45 g/mol |
| Exact Mass | 517.08 |
| IUPAC Name | 5-[(4-bromophenyl)sulfonylmethyl]-N-[3-(1,2,3,4-tetrahydroisoquinolin-2-ium-2-yl)propyl]furan-2-carboxamide |
| SMILES | O=C(NCCC[NH+]1CCc2ccccc2C1)c1ccc(CS(=O)(=O)c2ccc(Br)cc2)o1 |
| InChI | InChI=1S/C24H25BrN2O4S/c25-20-6-9-22(10-7-20)32(29,30)17-21-8-11-23(31-21)24(28)26-13-3-14-27-15-12-18-4-1-2-5-19(18)16-27/h1-2,4-11H,3,12-17H2,(H,26,28)/p+1 |
| InChIKey | UWRRBCYZENRUDP-UHFFFAOYSA-O |
| XLogP | 2.78 |
| TPSA | 80.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.45 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|