C11H19NO2S2 — CID 65243774
N-[(4,5-dimethylthiophen-2-yl)methyl]-2-ethylsulfonylethanamine (PubChem CID 65243774) has the molecular formula C11H19NO2S2 and a molecular weight of 261.41 g/mol. Its IUPAC name is N-[(4,5-dimethylthiophen-2-yl)methyl]-2-ethylsulfonylethanamine.
| Compound Name | N-[(4,5-dimethylthiophen-2-yl)methyl]-2-ethylsulfonylethanamine |
|---|---|
| PubChem CID | 65243774 |
| Molecular Formula | C11H19NO2S2 |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | N-[(4,5-dimethylthiophen-2-yl)methyl]-2-ethylsulfonylethanamine |
| SMILES | CCS(=O)(=O)CCNCc1cc(C)c(C)s1 |
| InChI | InChI=1S/C11H19NO2S2/c1-4-16(13,14)6-5-12-8-11-7-9(2)10(3)15-11/h7,12H,4-6,8H2,1-3H3 |
| InChIKey | ISJNPUDUSHCCNK-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|