C10H16FNS — CID 81105748
N-[(4,5-dimethylthiophen-2-yl)methyl]-3-fluoropropan-1-amine (PubChem CID 81105748) has the molecular formula C10H16FNS and a molecular weight of 201.31 g/mol. Its IUPAC name is N-[(4,5-dimethylthiophen-2-yl)methyl]-3-fluoropropan-1-amine.
| Compound Name | N-[(4,5-dimethylthiophen-2-yl)methyl]-3-fluoropropan-1-amine |
|---|---|
| PubChem CID | 81105748 |
| Molecular Formula | C10H16FNS |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.10 |
| IUPAC Name | N-[(4,5-dimethylthiophen-2-yl)methyl]-3-fluoropropan-1-amine |
| SMILES | Cc1cc(CNCCCF)sc1C |
| InChI | InChI=1S/C10H16FNS/c1-8-6-10(13-9(8)2)7-12-5-3-4-11/h6,12H,3-5,7H2,1-2H3 |
| InChIKey | SKGWKUMZGCJNAL-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|