C9H12ClNO2S2 — CID 63666222
1-chloro-N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)methanesulfonamide (PubChem CID 63666222) has the molecular formula C9H12ClNO2S2 and a molecular weight of 265.79 g/mol. Its IUPAC name is 1-chloro-N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)methanesulfonamide.
| Compound Name | 1-chloro-N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)methanesulfonamide |
|---|---|
| PubChem CID | 63666222 |
| Molecular Formula | C9H12ClNO2S2 |
| Molecular Weight | 265.79 g/mol |
| Exact Mass | 265.00 |
| IUPAC Name | 1-chloro-N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)methanesulfonamide |
| SMILES | O=S(=O)(CCl)NCc1cc2c(s1)CCC2 |
| InChI | InChI=1S/C9H12ClNO2S2/c10-6-15(12,13)11-5-8-4-7-2-1-3-9(7)14-8/h4,11H,1-3,5-6H2 |
| InChIKey | RHTASBKEGCAVTB-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.79 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|