C8H9BrS — CID 62726946
2-(bromomethyl)-5,6-dihydro-4H-cyclopenta[b]thiophene (PubChem CID 62726946) has the molecular formula C8H9BrS and a molecular weight of 217.13 g/mol. Its IUPAC name is 2-(bromomethyl)-5,6-dihydro-4H-cyclopenta[b]thiophene.
| Compound Name | 2-(bromomethyl)-5,6-dihydro-4H-cyclopenta[b]thiophene |
|---|---|
| PubChem CID | 62726946 |
| Molecular Formula | C8H9BrS |
| Molecular Weight | 217.13 g/mol |
| Exact Mass | 215.96 |
| IUPAC Name | 2-(bromomethyl)-5,6-dihydro-4H-cyclopenta[b]thiophene |
| SMILES | BrCc1cc2c(s1)CCC2 |
| InChI | InChI=1S/C8H9BrS/c9-5-7-4-6-2-1-3-8(6)10-7/h4H,1-3,5H2 |
| InChIKey | JJYGULMUAXUVLR-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.13 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|