C11H10BrNOS — CID 79154029
4-(bromomethyl)-5-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)-1,3-oxazole (PubChem CID 79154029) has the molecular formula C11H10BrNOS and a molecular weight of 284.18 g/mol. Its IUPAC name is 4-(bromomethyl)-5-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)-1,3-oxazole.
| Compound Name | 4-(bromomethyl)-5-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)-1,3-oxazole |
|---|---|
| PubChem CID | 79154029 |
| Molecular Formula | C11H10BrNOS |
| Molecular Weight | 284.18 g/mol |
| Exact Mass | 282.97 |
| IUPAC Name | 4-(bromomethyl)-5-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)-1,3-oxazole |
| SMILES | BrCc1ncoc1-c1cc2c(s1)CCC2 |
| InChI | InChI=1S/C11H10BrNOS/c12-5-8-11(14-6-13-8)10-4-7-2-1-3-9(7)15-10/h4,6H,1-3,5H2 |
| InChIKey | YQLAQFNDAVFTQC-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.18 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|