C14H16ClNOS — CID 65179946
2-(3-chloropropyl)-5-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-1,3-oxazole (PubChem CID 65179946) has the molecular formula C14H16ClNOS and a molecular weight of 281.81 g/mol. Its IUPAC name is 2-(3-chloropropyl)-5-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-1,3-oxazole.
| Compound Name | 2-(3-chloropropyl)-5-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-1,3-oxazole |
|---|---|
| PubChem CID | 65179946 |
| Molecular Formula | C14H16ClNOS |
| Molecular Weight | 281.81 g/mol |
| Exact Mass | 281.06 |
| IUPAC Name | 2-(3-chloropropyl)-5-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-1,3-oxazole |
| SMILES | ClCCCc1ncc(-c2cc3c(s2)CCCC3)o1 |
| InChI | InChI=1S/C14H16ClNOS/c15-7-3-6-14-16-9-11(17-14)13-8-10-4-1-2-5-12(10)18-13/h8-9H,1-7H2 |
| InChIKey | YTYRALSNYPJHTO-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.81 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|