C15H21BrN2OS — CID 79996430
N-[3-[5-(5-bromo-4-methylthiophen-2-yl)-1,3-oxazol-2-yl]propyl]-2-methylpropan-1-amine (PubChem CID 79996430) has the molecular formula C15H21BrN2OS and a molecular weight of 357.32 g/mol. Its IUPAC name is N-[3-[5-(5-bromo-4-methylthiophen-2-yl)-1,3-oxazol-2-yl]propyl]-2-methylpropan-1-amine.
| Compound Name | N-[3-[5-(5-bromo-4-methylthiophen-2-yl)-1,3-oxazol-2-yl]propyl]-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 79996430 |
| Molecular Formula | C15H21BrN2OS |
| Molecular Weight | 357.32 g/mol |
| Exact Mass | 356.06 |
| IUPAC Name | N-[3-[5-(5-bromo-4-methylthiophen-2-yl)-1,3-oxazol-2-yl]propyl]-2-methylpropan-1-amine |
| SMILES | Cc1cc(-c2cnc(CCCNCC(C)C)o2)sc1Br |
| InChI | InChI=1S/C15H21BrN2OS/c1-10(2)8-17-6-4-5-14-18-9-12(19-14)13-7-11(3)15(16)20-13/h7,9-10,17H,4-6,8H2,1-3H3 |
| InChIKey | UDEVBFJLNBTGAG-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.32 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|