C16H20F2N2O — CID 65184439
N-[3-[5-(3,5-difluorophenyl)-1,3-oxazol-2-yl]propyl]-2-methylpropan-1-amine (PubChem CID 65184439) has the molecular formula C16H20F2N2O and a molecular weight of 294.35 g/mol. Its IUPAC name is N-[3-[5-(3,5-difluorophenyl)-1,3-oxazol-2-yl]propyl]-2-methylpropan-1-amine.
| Compound Name | N-[3-[5-(3,5-difluorophenyl)-1,3-oxazol-2-yl]propyl]-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 65184439 |
| Molecular Formula | C16H20F2N2O |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | N-[3-[5-(3,5-difluorophenyl)-1,3-oxazol-2-yl]propyl]-2-methylpropan-1-amine |
| SMILES | CC(C)CNCCCc1ncc(-c2cc(F)cc(F)c2)o1 |
| InChI | InChI=1S/C16H20F2N2O/c1-11(2)9-19-5-3-4-16-20-10-15(21-16)12-6-13(17)8-14(18)7-12/h6-8,10-11,19H,3-5,9H2,1-2H3 |
| InChIKey | FXNMPEPFBHFTHK-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|