C16H24N2OS — CID 65238025
N-[3-[5-(4,5-dimethylthiophen-2-yl)-1,3-oxazol-2-yl]propyl]-2-methylpropan-2-amine (PubChem CID 65238025) has the molecular formula C16H24N2OS and a molecular weight of 292.45 g/mol. Its IUPAC name is N-[3-[5-(4,5-dimethylthiophen-2-yl)-1,3-oxazol-2-yl]propyl]-2-methylpropan-2-amine.
| Compound Name | N-[3-[5-(4,5-dimethylthiophen-2-yl)-1,3-oxazol-2-yl]propyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 65238025 |
| Molecular Formula | C16H24N2OS |
| Molecular Weight | 292.45 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | N-[3-[5-(4,5-dimethylthiophen-2-yl)-1,3-oxazol-2-yl]propyl]-2-methylpropan-2-amine |
| SMILES | Cc1cc(-c2cnc(CCCNC(C)(C)C)o2)sc1C |
| InChI | InChI=1S/C16H24N2OS/c1-11-9-14(20-12(11)2)13-10-17-15(19-13)7-6-8-18-16(3,4)5/h9-10,18H,6-8H2,1-5H3 |
| InChIKey | JEUZHMIWVIORKH-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.45 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|