C12H10ClF2NO — CID 65179486
2-(3-chloropropyl)-5-(2,4-difluorophenyl)-1,3-oxazole (PubChem CID 65179486) has the molecular formula C12H10ClF2NO and a molecular weight of 257.67 g/mol. Its IUPAC name is 2-(3-chloropropyl)-5-(2,4-difluorophenyl)-1,3-oxazole.
| Compound Name | 2-(3-chloropropyl)-5-(2,4-difluorophenyl)-1,3-oxazole |
|---|---|
| PubChem CID | 65179486 |
| Molecular Formula | C12H10ClF2NO |
| Molecular Weight | 257.67 g/mol |
| Exact Mass | 257.04 |
| IUPAC Name | 2-(3-chloropropyl)-5-(2,4-difluorophenyl)-1,3-oxazole |
| SMILES | Fc1ccc(-c2cnc(CCCCl)o2)c(F)c1 |
| InChI | InChI=1S/C12H10ClF2NO/c13-5-1-2-12-16-7-11(17-12)9-4-3-8(14)6-10(9)15/h3-4,6-7H,1-2,5H2 |
| InChIKey | LPNCTHZYRPTOMZ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.67 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|