C11H16S — CID 14338032
2-butyl-5,6-dihydro-4H-cyclopenta[b]thiophene (PubChem CID 14338032) has the molecular formula C11H16S and a molecular weight of 180.32 g/mol. Its IUPAC name is 2-butyl-5,6-dihydro-4H-cyclopenta[b]thiophene.
| Compound Name | 2-butyl-5,6-dihydro-4H-cyclopenta[b]thiophene |
|---|---|
| PubChem CID | 14338032 |
| Molecular Formula | C11H16S |
| Molecular Weight | 180.32 g/mol |
| Exact Mass | 180.10 |
| IUPAC Name | 2-butyl-5,6-dihydro-4H-cyclopenta[b]thiophene |
| SMILES | CCCCc1cc2c(s1)CCC2 |
| InChI | InChI=1S/C11H16S/c1-2-3-6-10-8-9-5-4-7-11(9)12-10/h8H,2-7H2,1H3 |
| InChIKey | XOHYMBXUCJAVQG-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.32 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |