C11H12S — CID 147453970
2-prop-2-ynyl-4,5,6,7-tetrahydro-1-benzothiophene (PubChem CID 147453970) has the molecular formula C11H12S and a molecular weight of 176.28 g/mol. Its IUPAC name is 2-prop-2-ynyl-4,5,6,7-tetrahydro-1-benzothiophene.
| Compound Name | 2-prop-2-ynyl-4,5,6,7-tetrahydro-1-benzothiophene |
|---|---|
| PubChem CID | 147453970 |
| Molecular Formula | C11H12S |
| Molecular Weight | 176.28 g/mol |
| Exact Mass | 176.07 |
| IUPAC Name | 2-prop-2-ynyl-4,5,6,7-tetrahydro-1-benzothiophene |
| SMILES | C#CCc1cc2c(s1)CCCC2 |
| InChI | InChI=1S/C11H12S/c1-2-5-10-8-9-6-3-4-7-11(9)12-10/h1,8H,3-7H2 |
| InChIKey | DYPJSSFJYKHVMG-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.28 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|