C12H12OS — CID 114972854
1-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)pent-4-yn-1-one (PubChem CID 114972854) has the molecular formula C12H12OS and a molecular weight of 204.29 g/mol. Its IUPAC name is 1-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)pent-4-yn-1-one.
| Compound Name | 1-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)pent-4-yn-1-one |
|---|---|
| PubChem CID | 114972854 |
| Molecular Formula | C12H12OS |
| Molecular Weight | 204.29 g/mol |
| Exact Mass | 204.06 |
| IUPAC Name | 1-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)pent-4-yn-1-one |
| SMILES | C#CCCC(=O)c1cc2c(s1)CCC2 |
| InChI | InChI=1S/C12H12OS/c1-2-3-6-10(13)12-8-9-5-4-7-11(9)14-12/h1,8H,3-7H2 |
| InChIKey | NKTZXKWQVXIQHM-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.29 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|