C13H16OS — CID 114974846
1-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)hex-5-en-1-one (PubChem CID 114974846) has the molecular formula C13H16OS and a molecular weight of 220.34 g/mol. Its IUPAC name is 1-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)hex-5-en-1-one.
| Compound Name | 1-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)hex-5-en-1-one |
|---|---|
| PubChem CID | 114974846 |
| Molecular Formula | C13H16OS |
| Molecular Weight | 220.34 g/mol |
| Exact Mass | 220.09 |
| IUPAC Name | 1-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)hex-5-en-1-one |
| SMILES | C=CCCCC(=O)c1cc2c(s1)CCC2 |
| InChI | InChI=1S/C13H16OS/c1-2-3-4-7-11(14)13-9-10-6-5-8-12(10)15-13/h2,9H,1,3-8H2 |
| InChIKey | LPEGDIKEXRBIHK-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.34 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|