About 6-bromo-N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)pyrimidin-4-amine
6-bromo-N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)pyrimidin-4-amine (PubChem CID 106194029) has the molecular formula C12H12BrN3S
and a molecular weight of 310.22 g/mol. Its IUPAC name is 6-bromo-N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)pyrimidin-4-amine.
Molecular Properties
| Compound Name | 6-bromo-N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)pyrimidin-4-amine |
| PubChem CID | 106194029 |
| Molecular Formula | C12H12BrN3S |
| Molecular Weight | 310.22 g/mol |
| Exact Mass | 308.99 |
| IUPAC Name | 6-bromo-N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)pyrimidin-4-amine |
| SMILES | Brc1cc(NCc2cc3c(s2)CCC3)ncn1 |
| InChI | InChI=1S/C12H12BrN3S/c13-11-5-12(16-7-15-11)14-6-9-4-8-2-1-3-10(8)17-9/h4-5,7H,1-3,6H2,(H,14,15,16) |
| InChIKey | DKNNKASCQBFAHS-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.22 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-bromo-N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)pyrimidin-4-amine?
The IUPAC name of 6-bromo-N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)pyrimidin-4-amine (CID 106194029) is 6-bromo-N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)pyrimidin-4-amine.
What is the SMILES notation for 6-bromo-N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)pyrimidin-4-amine?
The canonical SMILES for 6-bromo-N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)pyrimidin-4-amine is Brc1cc(NCc2cc3c(s2)CCC3)ncn1.
What is the InChIKey of 6-bromo-N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)pyrimidin-4-amine?
The InChIKey is DKNNKASCQBFAHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12BrN3S/c13-11-5-12(16-7-15-11)14-6-9-4-8-2-1-3-10(8)17-9/h4-5,7H,1-3,6H2,(H,14,15,16).
What are the key properties of 6-bromo-N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)pyrimidin-4-amine?
6-bromo-N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)pyrimidin-4-amine has a molecular weight of 310.22 g/mol, XLogP of 3.40, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)pyrimidin-4-amine is sourced from PubChem (CID 106194029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).