C13H13FN2S — CID 106194051
N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)-2-fluoropyridin-4-amine (PubChem CID 106194051) has the molecular formula C13H13FN2S and a molecular weight of 248.33 g/mol. Its IUPAC name is N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)-2-fluoropyridin-4-amine.
| Compound Name | N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)-2-fluoropyridin-4-amine |
|---|---|
| PubChem CID | 106194051 |
| Molecular Formula | C13H13FN2S |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)-2-fluoropyridin-4-amine |
| SMILES | Fc1cc(NCc2cc3c(s2)CCC3)ccn1 |
| InChI | InChI=1S/C13H13FN2S/c14-13-7-10(4-5-15-13)16-8-11-6-9-2-1-3-12(9)17-11/h4-7H,1-3,8H2,(H,15,16) |
| InChIKey | RVLGIRVCZRKGIA-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|