C14H14N2O2S — CID 61208190
N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)-3-nitroaniline (PubChem CID 61208190) has the molecular formula C14H14N2O2S and a molecular weight of 274.34 g/mol. Its IUPAC name is N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)-3-nitroaniline.
| Compound Name | N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)-3-nitroaniline |
|---|---|
| PubChem CID | 61208190 |
| Molecular Formula | C14H14N2O2S |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)-3-nitroaniline |
| SMILES | O=[N+]([O-])c1cccc(NCc2cc3c(s2)CCC3)c1 |
| InChI | InChI=1S/C14H14N2O2S/c17-16(18)12-5-2-4-11(8-12)15-9-13-7-10-3-1-6-14(10)19-13/h2,4-5,7-8,15H,1,3,6,9H2 |
| InChIKey | BPHVZWJHEZGAGX-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|