C12H16ClNOS — CID 62728528
3-chloro-N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)-2-methylpropanamide (PubChem CID 62728528) has the molecular formula C12H16ClNOS and a molecular weight of 257.79 g/mol. Its IUPAC name is 3-chloro-N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)-2-methylpropanamide.
| Compound Name | 3-chloro-N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)-2-methylpropanamide |
|---|---|
| PubChem CID | 62728528 |
| Molecular Formula | C12H16ClNOS |
| Molecular Weight | 257.79 g/mol |
| Exact Mass | 257.06 |
| IUPAC Name | 3-chloro-N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)-2-methylpropanamide |
| SMILES | CC(CCl)C(=O)NCc1cc2c(s1)CCC2 |
| InChI | InChI=1S/C12H16ClNOS/c1-8(6-13)12(15)14-7-10-5-9-3-2-4-11(9)16-10/h5,8H,2-4,6-7H2,1H3,(H,14,15) |
| InChIKey | ZOYIXOPUJRPTSE-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.79 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|