C15H14Cl2N2OS — CID 82812054
4-amino-3,5-dichloro-N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)benzamide (PubChem CID 82812054) has the molecular formula C15H14Cl2N2OS and a molecular weight of 341.26 g/mol. Its IUPAC name is 4-amino-3,5-dichloro-N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)benzamide.
| Compound Name | 4-amino-3,5-dichloro-N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 82812054 |
| Molecular Formula | C15H14Cl2N2OS |
| Molecular Weight | 341.26 g/mol |
| Exact Mass | 340.02 |
| IUPAC Name | 4-amino-3,5-dichloro-N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)benzamide |
| SMILES | Nc1c(Cl)cc(C(=O)NCc2cc3c(s2)CCC3)cc1Cl |
| InChI | InChI=1S/C15H14Cl2N2OS/c16-11-5-9(6-12(17)14(11)18)15(20)19-7-10-4-8-2-1-3-13(8)21-10/h4-6H,1-3,7,18H2,(H,19,20) |
| InChIKey | CBKKCULUGIFYRS-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.26 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|