C14H12BrClN2OS — CID 62000467
5-bromo-2-chloro-N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)pyridine-3-carboxamide (PubChem CID 62000467) has the molecular formula C14H12BrClN2OS and a molecular weight of 371.69 g/mol. Its IUPAC name is 5-bromo-2-chloro-N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)pyridine-3-carboxamide.
| Compound Name | 5-bromo-2-chloro-N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 62000467 |
| Molecular Formula | C14H12BrClN2OS |
| Molecular Weight | 371.69 g/mol |
| Exact Mass | 369.95 |
| IUPAC Name | 5-bromo-2-chloro-N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)pyridine-3-carboxamide |
| SMILES | O=C(NCc1cc2c(s1)CCC2)c1cc(Br)cnc1Cl |
| InChI | InChI=1S/C14H12BrClN2OS/c15-9-5-11(13(16)17-6-9)14(19)18-7-10-4-8-2-1-3-12(8)20-10/h4-6H,1-3,7H2,(H,18,19) |
| InChIKey | GAAIFGXLSOXBQS-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.69 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|