C16H17BrN2OS — CID 107872496
3-amino-5-bromo-N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)-2-methylbenzamide (PubChem CID 107872496) has the molecular formula C16H17BrN2OS and a molecular weight of 365.30 g/mol. Its IUPAC name is 3-amino-5-bromo-N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)-2-methylbenzamide.
| Compound Name | 3-amino-5-bromo-N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)-2-methylbenzamide |
|---|---|
| PubChem CID | 107872496 |
| Molecular Formula | C16H17BrN2OS |
| Molecular Weight | 365.30 g/mol |
| Exact Mass | 364.02 |
| IUPAC Name | 3-amino-5-bromo-N-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethyl)-2-methylbenzamide |
| SMILES | Cc1c(N)cc(Br)cc1C(=O)NCc1cc2c(s1)CCC2 |
| InChI | InChI=1S/C16H17BrN2OS/c1-9-13(6-11(17)7-14(9)18)16(20)19-8-12-5-10-3-2-4-15(10)21-12/h5-7H,2-4,8,18H2,1H3,(H,19,20) |
| InChIKey | HSDKJXWKBSTGOC-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.30 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|