C11H16N2OS — CID 61208365
3-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethylamino)propanamide (PubChem CID 61208365) has the molecular formula C11H16N2OS and a molecular weight of 224.33 g/mol. Its IUPAC name is 3-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethylamino)propanamide.
| Compound Name | 3-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethylamino)propanamide |
|---|---|
| PubChem CID | 61208365 |
| Molecular Formula | C11H16N2OS |
| Molecular Weight | 224.33 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | 3-(5,6-dihydro-4H-cyclopenta[b]thiophen-2-ylmethylamino)propanamide |
| SMILES | NC(=O)CCNCc1cc2c(s1)CCC2 |
| InChI | InChI=1S/C11H16N2OS/c12-11(14)4-5-13-7-9-6-8-2-1-3-10(8)15-9/h6,13H,1-5,7H2,(H2,12,14) |
| InChIKey | QRDIOPBHYHZLKX-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.33 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|