C11H18BrNO2S2 — CID 79994653
5-bromo-4-methyl-N-(2-methylpentan-3-yl)thiophene-2-sulfonamide (PubChem CID 79994653) has the molecular formula C11H18BrNO2S2 and a molecular weight of 340.31 g/mol. Its IUPAC name is 5-bromo-4-methyl-N-(2-methylpentan-3-yl)thiophene-2-sulfonamide.
| Compound Name | 5-bromo-4-methyl-N-(2-methylpentan-3-yl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 79994653 |
| Molecular Formula | C11H18BrNO2S2 |
| Molecular Weight | 340.31 g/mol |
| Exact Mass | 339.00 |
| IUPAC Name | 5-bromo-4-methyl-N-(2-methylpentan-3-yl)thiophene-2-sulfonamide |
| SMILES | CCC(NS(=O)(=O)c1cc(C)c(Br)s1)C(C)C |
| InChI | InChI=1S/C11H18BrNO2S2/c1-5-9(7(2)3)13-17(14,15)10-6-8(4)11(12)16-10/h6-7,9,13H,5H2,1-4H3 |
| InChIKey | WTIBZVZFJMCHQE-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.31 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |