C9H13Br2NO2S2 — CID 83180558
5-bromo-N-(4-bromobutan-2-yl)-4-methylthiophene-2-sulfonamide (PubChem CID 83180558) has the molecular formula C9H13Br2NO2S2 and a molecular weight of 391.15 g/mol. Its IUPAC name is 5-bromo-N-(4-bromobutan-2-yl)-4-methylthiophene-2-sulfonamide.
| Compound Name | 5-bromo-N-(4-bromobutan-2-yl)-4-methylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 83180558 |
| Molecular Formula | C9H13Br2NO2S2 |
| Molecular Weight | 391.15 g/mol |
| Exact Mass | 388.88 |
| IUPAC Name | 5-bromo-N-(4-bromobutan-2-yl)-4-methylthiophene-2-sulfonamide |
| SMILES | Cc1cc(S(=O)(=O)NC(C)CCBr)sc1Br |
| InChI | InChI=1S/C9H13Br2NO2S2/c1-6-5-8(15-9(6)11)16(13,14)12-7(2)3-4-10/h5,7,12H,3-4H2,1-2H3 |
| InChIKey | KLJKGEDQBZKWFN-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.15 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|