C11H17Br2NO2S2 — CID 113271709
5-bromo-N-(1-bromo-4-methylpentan-2-yl)-4-methylthiophene-2-sulfonamide (PubChem CID 113271709) has the molecular formula C11H17Br2NO2S2 and a molecular weight of 419.20 g/mol. Its IUPAC name is 5-bromo-N-(1-bromo-4-methylpentan-2-yl)-4-methylthiophene-2-sulfonamide.
| Compound Name | 5-bromo-N-(1-bromo-4-methylpentan-2-yl)-4-methylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 113271709 |
| Molecular Formula | C11H17Br2NO2S2 |
| Molecular Weight | 419.20 g/mol |
| Exact Mass | 416.91 |
| IUPAC Name | 5-bromo-N-(1-bromo-4-methylpentan-2-yl)-4-methylthiophene-2-sulfonamide |
| SMILES | Cc1cc(S(=O)(=O)NC(CBr)CC(C)C)sc1Br |
| InChI | InChI=1S/C11H17Br2NO2S2/c1-7(2)4-9(6-12)14-18(15,16)10-5-8(3)11(13)17-10/h5,7,9,14H,4,6H2,1-3H3 |
| InChIKey | WGYRDDOKKYEDIA-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.20 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|