C13H25N3O2S2 — CID 106055612
5-(ethylaminomethyl)-N-[2-[methyl(propan-2-yl)amino]ethyl]thiophene-2-sulfonamide (PubChem CID 106055612) has the molecular formula C13H25N3O2S2 and a molecular weight of 319.50 g/mol. Its IUPAC name is 5-(ethylaminomethyl)-N-[2-[methyl(propan-2-yl)amino]ethyl]thiophene-2-sulfonamide.
| Compound Name | 5-(ethylaminomethyl)-N-[2-[methyl(propan-2-yl)amino]ethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 106055612 |
| Molecular Formula | C13H25N3O2S2 |
| Molecular Weight | 319.50 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | 5-(ethylaminomethyl)-N-[2-[methyl(propan-2-yl)amino]ethyl]thiophene-2-sulfonamide |
| SMILES | CCNCc1ccc(S(=O)(=O)NCCN(C)C(C)C)s1 |
| InChI | InChI=1S/C13H25N3O2S2/c1-5-14-10-12-6-7-13(19-12)20(17,18)15-8-9-16(4)11(2)3/h6-7,11,14-15H,5,8-10H2,1-4H3 |
| InChIKey | LVDXUJHZFQRRAV-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.50 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |