C9H17N3O2S2 — CID 106074733
5-(ethylaminomethyl)-N',N'-dimethylthiophene-2-sulfonohydrazide (PubChem CID 106074733) has the molecular formula C9H17N3O2S2 and a molecular weight of 263.39 g/mol. Its IUPAC name is 5-(ethylaminomethyl)-N',N'-dimethylthiophene-2-sulfonohydrazide.
| Compound Name | 5-(ethylaminomethyl)-N',N'-dimethylthiophene-2-sulfonohydrazide |
|---|---|
| PubChem CID | 106074733 |
| Molecular Formula | C9H17N3O2S2 |
| Molecular Weight | 263.39 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | 5-(ethylaminomethyl)-N',N'-dimethylthiophene-2-sulfonohydrazide |
| SMILES | CCNCc1ccc(S(=O)(=O)NN(C)C)s1 |
| InChI | InChI=1S/C9H17N3O2S2/c1-4-10-7-8-5-6-9(15-8)16(13,14)11-12(2)3/h5-6,10-11H,4,7H2,1-3H3 |
| InChIKey | SUQMMFIZNNCHPA-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.39 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|