C13H25ClN2O3S2 — CID 120717305
5-tert-butyl-N-[2-(2-methoxyethylamino)ethyl]thiophene-2-sulfonamide;hydrochloride (PubChem CID 120717305) has the molecular formula C13H25ClN2O3S2 and a molecular weight of 356.94 g/mol. Its IUPAC name is 5-tert-butyl-N-[2-(2-methoxyethylamino)ethyl]thiophene-2-sulfonamide;hydrochloride.
| Compound Name | 5-tert-butyl-N-[2-(2-methoxyethylamino)ethyl]thiophene-2-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120717305 |
| Molecular Formula | C13H25ClN2O3S2 |
| Molecular Weight | 356.94 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | 5-tert-butyl-N-[2-(2-methoxyethylamino)ethyl]thiophene-2-sulfonamide;hydrochloride |
| SMILES | COCCNCCNS(=O)(=O)c1ccc(C(C)(C)C)s1.Cl |
| InChI | InChI=1S/C13H24N2O3S2.ClH/c1-13(2,3)11-5-6-12(19-11)20(16,17)15-8-7-14-9-10-18-4;/h5-6,14-15H,7-10H2,1-4H3;1H |
| InChIKey | ZMOILIUYVBRMBW-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.94 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|