C16H26ClN3O3S2 — CID 120717580
2-tert-butyl-N-[2-(2-methoxyethylamino)ethyl]-1,3-benzothiazole-6-sulfonamide;hydrochloride (PubChem CID 120717580) has the molecular formula C16H26ClN3O3S2 and a molecular weight of 407.99 g/mol. Its IUPAC name is 2-tert-butyl-N-[2-(2-methoxyethylamino)ethyl]-1,3-benzothiazole-6-sulfonamide;hydrochloride.
| Compound Name | 2-tert-butyl-N-[2-(2-methoxyethylamino)ethyl]-1,3-benzothiazole-6-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120717580 |
| Molecular Formula | C16H26ClN3O3S2 |
| Molecular Weight | 407.99 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | 2-tert-butyl-N-[2-(2-methoxyethylamino)ethyl]-1,3-benzothiazole-6-sulfonamide;hydrochloride |
| SMILES | COCCNCCNS(=O)(=O)c1ccc2nc(C(C)(C)C)sc2c1.Cl |
| InChI | InChI=1S/C16H25N3O3S2.ClH/c1-16(2,3)15-19-13-6-5-12(11-14(13)23-15)24(20,21)18-8-7-17-9-10-22-4;/h5-6,11,17-18H,7-10H2,1-4H3;1H |
| InChIKey | WTQLMBOADUXMQW-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.99 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|