C15H24ClN3O2S2 — CID 120583757
N-(4-aminobutyl)-2-tert-butyl-1,3-benzothiazole-6-sulfonamide;hydrochloride (PubChem CID 120583757) has the molecular formula C15H24ClN3O2S2 and a molecular weight of 377.96 g/mol. Its IUPAC name is N-(4-aminobutyl)-2-tert-butyl-1,3-benzothiazole-6-sulfonamide;hydrochloride.
| Compound Name | N-(4-aminobutyl)-2-tert-butyl-1,3-benzothiazole-6-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120583757 |
| Molecular Formula | C15H24ClN3O2S2 |
| Molecular Weight | 377.96 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | N-(4-aminobutyl)-2-tert-butyl-1,3-benzothiazole-6-sulfonamide;hydrochloride |
| SMILES | CC(C)(C)c1nc2ccc(S(=O)(=O)NCCCCN)cc2s1.Cl |
| InChI | InChI=1S/C15H23N3O2S2.ClH/c1-15(2,3)14-18-12-7-6-11(10-13(12)21-14)22(19,20)17-9-5-4-8-16;/h6-7,10,17H,4-5,8-9,16H2,1-3H3;1H |
| InChIKey | IGNOEGPVXXSIQG-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.96 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|