C19H22N2O4S3 — CID 133324024
N-[2,4-bis(methylsulfonyl)phenyl]-2-tert-butyl-1,3-benzothiazol-6-amine (PubChem CID 133324024) has the molecular formula C19H22N2O4S3 and a molecular weight of 438.60 g/mol. Its IUPAC name is N-[2,4-bis(methylsulfonyl)phenyl]-2-tert-butyl-1,3-benzothiazol-6-amine.
| Compound Name | N-[2,4-bis(methylsulfonyl)phenyl]-2-tert-butyl-1,3-benzothiazol-6-amine |
|---|---|
| PubChem CID | 133324024 |
| Molecular Formula | C19H22N2O4S3 |
| Molecular Weight | 438.60 g/mol |
| Exact Mass | 438.07 |
| IUPAC Name | N-[2,4-bis(methylsulfonyl)phenyl]-2-tert-butyl-1,3-benzothiazol-6-amine |
| SMILES | CC(C)(C)c1nc2ccc(Nc3ccc(S(C)(=O)=O)cc3S(C)(=O)=O)cc2s1 |
| InChI | InChI=1S/C19H22N2O4S3/c1-19(2,3)18-21-14-8-6-12(10-16(14)26-18)20-15-9-7-13(27(4,22)23)11-17(15)28(5,24)25/h6-11,20H,1-5H3 |
| InChIKey | NPLCJZAZKXCBBE-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 93.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.60 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |