C18H18N4O4S2 — CID 24606889
N-(4-methylsulfonyl-2-nitrophenyl)-2-pyrrolidin-1-yl-1,3-benzothiazol-6-amine (PubChem CID 24606889) has the molecular formula C18H18N4O4S2 and a molecular weight of 418.50 g/mol. Its IUPAC name is N-(4-methylsulfonyl-2-nitrophenyl)-2-pyrrolidin-1-yl-1,3-benzothiazol-6-amine.
| Compound Name | N-(4-methylsulfonyl-2-nitrophenyl)-2-pyrrolidin-1-yl-1,3-benzothiazol-6-amine |
|---|---|
| PubChem CID | 24606889 |
| Molecular Formula | C18H18N4O4S2 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.08 |
| IUPAC Name | N-(4-methylsulfonyl-2-nitrophenyl)-2-pyrrolidin-1-yl-1,3-benzothiazol-6-amine |
| SMILES | CS(=O)(=O)c1ccc(Nc2ccc3nc(N4CCCC4)sc3c2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H18N4O4S2/c1-28(25,26)13-5-7-14(16(11-13)22(23)24)19-12-4-6-15-17(10-12)27-18(20-15)21-8-2-3-9-21/h4-7,10-11,19H,2-3,8-9H2,1H3 |
| InChIKey | LAGQMPJJVLPXFZ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 105.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|