C15H13N3O5S — CID 9339179
2-methyl-N-(4-methylsulfonyl-2-nitrophenyl)-1,3-benzoxazol-5-amine (PubChem CID 9339179) has the molecular formula C15H13N3O5S and a molecular weight of 347.35 g/mol. Its IUPAC name is 2-methyl-N-(4-methylsulfonyl-2-nitrophenyl)-1,3-benzoxazol-5-amine.
| Compound Name | 2-methyl-N-(4-methylsulfonyl-2-nitrophenyl)-1,3-benzoxazol-5-amine |
|---|---|
| PubChem CID | 9339179 |
| Molecular Formula | C15H13N3O5S |
| Molecular Weight | 347.35 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | 2-methyl-N-(4-methylsulfonyl-2-nitrophenyl)-1,3-benzoxazol-5-amine |
| SMILES | Cc1nc2cc(Nc3ccc(S(C)(=O)=O)cc3[N+](=O)[O-])ccc2o1 |
| InChI | InChI=1S/C15H13N3O5S/c1-9-16-13-7-10(3-6-15(13)23-9)17-12-5-4-11(24(2,21)22)8-14(12)18(19)20/h3-8,17H,1-2H3 |
| InChIKey | VBJPMUXCHGOQCK-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 115.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.35 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|