C15H13N3O3 — CID 28676165
2-methyl-N-[(2-nitrophenyl)methyl]-1,3-benzoxazol-5-amine (PubChem CID 28676165) has the molecular formula C15H13N3O3 and a molecular weight of 283.29 g/mol. Its IUPAC name is 2-methyl-N-[(2-nitrophenyl)methyl]-1,3-benzoxazol-5-amine.
| Compound Name | 2-methyl-N-[(2-nitrophenyl)methyl]-1,3-benzoxazol-5-amine |
|---|---|
| PubChem CID | 28676165 |
| Molecular Formula | C15H13N3O3 |
| Molecular Weight | 283.29 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 2-methyl-N-[(2-nitrophenyl)methyl]-1,3-benzoxazol-5-amine |
| SMILES | Cc1nc2cc(NCc3ccccc3[N+](=O)[O-])ccc2o1 |
| InChI | InChI=1S/C15H13N3O3/c1-10-17-13-8-12(6-7-15(13)21-10)16-9-11-4-2-3-5-14(11)18(19)20/h2-8,16H,9H2,1H3 |
| InChIKey | JGJFXDCWZIPZQG-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 81.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.29 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|