C15H14N2O3 — CID 28675939
4-[[(2-methyl-1,3-benzoxazol-5-yl)amino]methyl]benzene-1,3-diol (PubChem CID 28675939) has the molecular formula C15H14N2O3 and a molecular weight of 270.29 g/mol. Its IUPAC name is 4-[[(2-methyl-1,3-benzoxazol-5-yl)amino]methyl]benzene-1,3-diol.
| Compound Name | 4-[[(2-methyl-1,3-benzoxazol-5-yl)amino]methyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 28675939 |
| Molecular Formula | C15H14N2O3 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 4-[[(2-methyl-1,3-benzoxazol-5-yl)amino]methyl]benzene-1,3-diol |
| SMILES | Cc1nc2cc(NCc3ccc(O)cc3O)ccc2o1 |
| InChI | InChI=1S/C15H14N2O3/c1-9-17-13-6-11(3-5-15(13)20-9)16-8-10-2-4-12(18)7-14(10)19/h2-7,16,18-19H,8H2,1H3 |
| InChIKey | LZNHTSMVENEOII-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 78.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|