C16H16N2O3 — CID 60931175
4-[[(2-ethyl-1,3-benzoxazol-5-yl)amino]methyl]benzene-1,3-diol (PubChem CID 60931175) has the molecular formula C16H16N2O3 and a molecular weight of 284.32 g/mol. Its IUPAC name is 4-[[(2-ethyl-1,3-benzoxazol-5-yl)amino]methyl]benzene-1,3-diol.
| Compound Name | 4-[[(2-ethyl-1,3-benzoxazol-5-yl)amino]methyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 60931175 |
| Molecular Formula | C16H16N2O3 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | 4-[[(2-ethyl-1,3-benzoxazol-5-yl)amino]methyl]benzene-1,3-diol |
| SMILES | CCc1nc2cc(NCc3ccc(O)cc3O)ccc2o1 |
| InChI | InChI=1S/C16H16N2O3/c1-2-16-18-13-7-11(4-6-15(13)21-16)17-9-10-3-5-12(19)8-14(10)20/h3-8,17,19-20H,2,9H2,1H3 |
| InChIKey | WLBGFYGBJKPYAC-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 78.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|